C33H80O2 — CID 162009932
methane;2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol (PubChem CID 162009932) has the molecular formula C33H80O2 and a molecular weight of 509.00 g/mol. Its IUPAC name is methane;2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol.
| Compound Name | methane;2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 162009932 |
| Molecular Formula | C33H80O2 |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.62 |
| IUPAC Name | methane;2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol |
| SMILES | C.C.C.C.C.C.C.C.C.C.C.C.C=C(C)C1CCC(C)CC1c1c(O)cc(CCCCC)cc1O |
| InChI | InChI=1S/C21H32O2.12CH4/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3;;;;;;;;;;;;/h12-13,15,17-18,22-23H,2,5-11H2,1,3-4H3;12*1H4 |
| InChIKey | YTIKCJNLHVTCTE-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|