C21H26B4O3 — CID 174042717
CID 174042717 (PubChem CID 174042717) has the molecular formula C21H26B4O3 and a molecular weight of 369.68 g/mol.
| Compound Name | CID 174042717 |
|---|---|
| PubChem CID | 174042717 |
| Molecular Formula | C21H26B4O3 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C1=CC(c2c(O)cc(CCCCC)cc2O)C(C(=C)C)CC1([B])[B] |
| InChI | InChI=1S/C21H26B4O3/c1-4-5-6-7-13-8-16(26)19(17(27)9-13)14-10-18(21(24,25)28)20(22,23)11-15(14)12(2)3/h8-10,14-15,26-28H,2,4-7,11H2,1,3H3 |
| InChIKey | IVDHHJKLITYANX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|