C23H29B5O2 — CID 156648718
CID 156648718 (PubChem CID 156648718) has the molecular formula C23H29B5O2 and a molecular weight of 391.54 g/mol.
| Compound Name | CID 156648718 |
|---|---|
| PubChem CID | 156648718 |
| Molecular Formula | C23H29B5O2 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | — |
| SMILES | [B]C([B])=C(C)C1CCC(C([B])([B])[B])=CC1c1c(O)cc(CCCCCCC)cc1O |
| InChI | InChI=1S/C23H29B5O2/c1-3-4-5-6-7-8-15-11-19(29)21(20(30)12-15)18-13-16(23(26,27)28)9-10-17(18)14(2)22(24)25/h11-13,17-18,29-30H,3-10H2,1-2H3 |
| InChIKey | OXLXRWGQYBQXGW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|