C21H33IO2 — CID 170456936
4-iodo-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol (PubChem CID 170456936) has the molecular formula C21H33IO2 and a molecular weight of 444.40 g/mol. Its IUPAC name is 4-iodo-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol.
| Compound Name | 4-iodo-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 170456936 |
| Molecular Formula | C21H33IO2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-iodo-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c([C@@H]2C[C@H](C)CC[C@H]2C(C)C)c(O)c1I |
| InChI | InChI=1S/C21H33IO2/c1-5-6-7-8-15-12-18(23)19(21(24)20(15)22)17-11-14(4)9-10-16(17)13(2)3/h12-14,16-17,23-24H,5-11H2,1-4H3/t14-,16+,17-/m1/s1 |
| InChIKey | WQLPEZJCNNDNQY-HYVNUMGLSA-N |
| XLogP | 6.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|