C29H45NO4 — CID 90128568
[(1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexyl]-morpholin-4-ylmethanone (PubChem CID 90128568) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is [(1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexyl]-morpholin-4-ylmethanone.
| Compound Name | [(1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 90128568 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | [(1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexyl]-morpholin-4-ylmethanone |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C(=O)N2CCOCC2)C[C@H]1c1c(O)cc(C(C)(C)CCCCCC)cc1O |
| InChI | InChI=1S/C29H45NO4/c1-6-7-8-9-12-29(4,5)22-18-25(31)27(26(32)19-22)24-17-21(10-11-23(24)20(2)3)28(33)30-13-15-34-16-14-30/h18-19,21,23-24,31-32H,2,6-17H2,1,3-5H3/t21-,23+,24-/m1/s1 |
| InChIKey | YIYZTVOQKUSWMR-YFNKSVMNSA-N |
| XLogP | 6.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|