C37H59NO6 — CID 166758551
[(6aS,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 166758551) has the molecular formula C37H59NO6 and a molecular weight of 613.88 g/mol. Its IUPAC name is [(6aS,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | [(6aS,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 166758551 |
| Molecular Formula | C37H59NO6 |
| Molecular Weight | 613.88 g/mol |
| Exact Mass | 613.43 |
| IUPAC Name | [(6aS,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(=O)C(C)(C)CCCCNC(=O)OC(C)(C)C)c2c(c1)OC(C)(C)[C@H]1CCC(=O)C[C@@H]21 |
| InChI | InChI=1S/C37H59NO6/c1-11-12-13-14-19-35(5,6)25-22-29(31-27-24-26(39)17-18-28(27)37(9,10)43-30(31)23-25)42-32(40)36(7,8)20-15-16-21-38-33(41)44-34(2,3)4/h22-23,27-28H,11-21,24H2,1-10H3,(H,38,41)/t27-,28+/m1/s1 |
| InChIKey | RCGPFCYXHAXHLN-IZLXSDGUSA-N |
| XLogP | 9.19 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.88 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|