C11H16N2OS — CID 63037041
N-cyclopentyl-N-ethyl-1,3-thiazole-4-carboxamide (PubChem CID 63037041) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-cyclopentyl-N-ethyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-cyclopentyl-N-ethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63037041 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-cyclopentyl-N-ethyl-1,3-thiazole-4-carboxamide |
| SMILES | CCN(C(=O)c1cscn1)C1CCCC1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-13(9-5-3-4-6-9)11(14)10-7-15-8-12-10/h7-9H,2-6H2,1H3 |
| InChIKey | ZIAINIXISRKZAD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |