C30H45NO5 — CID 57013488
[(6aS,10aR)-9-[di(propanoyl)amino]-3-heptan-3-yl-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] acetate (PubChem CID 57013488) has the molecular formula C30H45NO5 and a molecular weight of 499.69 g/mol. Its IUPAC name is [(6aS,10aR)-9-[di(propanoyl)amino]-3-heptan-3-yl-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] acetate.
| Compound Name | [(6aS,10aR)-9-[di(propanoyl)amino]-3-heptan-3-yl-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] acetate |
|---|---|
| PubChem CID | 57013488 |
| Molecular Formula | C30H45NO5 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | [(6aS,10aR)-9-[di(propanoyl)amino]-3-heptan-3-yl-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] acetate |
| SMILES | CCCCC(CC)c1cc(OC(C)=O)c2c(c1)OC(C)(C)[C@H]1CCC(N(C(=O)CC)C(=O)CC)C[C@@H]21 |
| InChI | InChI=1S/C30H45NO5/c1-8-12-13-20(9-2)21-16-25(35-19(5)32)29-23-18-22(31(27(33)10-3)28(34)11-4)14-15-24(23)30(6,7)36-26(29)17-21/h16-17,20,22-24H,8-15,18H2,1-7H3/t20?,22?,23-,24+/m1/s1 |
| InChIKey | LYWLEWTWOOZMHD-GXYBFCANSA-N |
| XLogP | 6.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|