C12H8F3NO3 — CID 101421656
8-methyl-4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol (PubChem CID 101421656) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is 8-methyl-4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol.
| Compound Name | 8-methyl-4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
|---|---|
| PubChem CID | 101421656 |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 8-methyl-4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
| SMILES | Cc1ccc2c(c1)-c1oncc1C(O)(C(F)(F)F)O2 |
| InChI | InChI=1S/C12H8F3NO3/c1-6-2-3-9-7(4-6)10-8(5-16-19-10)11(17,18-9)12(13,14)15/h2-5,17H,1H3 |
| InChIKey | XLRIPZCRPIJYDK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |