C10H10Cl5N2O2P — CID 13354561
2,4'-dichloro-1',3'-dimethyl-4'-(trichloromethyl)spiro[1,3,2lambda5-benzodioxaphosphole-2,2'-1,3-diaza-2lambda5-phosphacyclobutane] (PubChem CID 13354561) has the molecular formula C10H10Cl5N2O2P and a molecular weight of 398.44 g/mol. Its IUPAC name is 2,4'-dichloro-1',3'-dimethyl-4'-(trichloromethyl)spiro[1,3,2lambda5-benzodioxaphosphole-2,2'-1,3-diaza-2lambda5-phosphacyclobutane].
| Compound Name | 2,4'-dichloro-1',3'-dimethyl-4'-(trichloromethyl)spiro[1,3,2lambda5-benzodioxaphosphole-2,2'-1,3-diaza-2lambda5-phosphacyclobutane] |
|---|---|
| PubChem CID | 13354561 |
| Molecular Formula | C10H10Cl5N2O2P |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 2,4'-dichloro-1',3'-dimethyl-4'-(trichloromethyl)spiro[1,3,2lambda5-benzodioxaphosphole-2,2'-1,3-diaza-2lambda5-phosphacyclobutane] |
| SMILES | CN1C(Cl)(C(Cl)(Cl)Cl)N(C)P12(Cl)Oc1ccccc1O2 |
| InChI | InChI=1S/C10H10Cl5N2O2P/c1-16-10(14,9(11,12)13)17(2)20(16,15)18-7-5-3-4-6-8(7)19-20/h3-6H,1-2H3 |
| InChIKey | XYIQPPBQBMPMDO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|