C11H12Cl3NO — CID 121224214
3-propyl-2-(trichloromethyl)-2H-1,3-benzoxazole (PubChem CID 121224214) has the molecular formula C11H12Cl3NO and a molecular weight of 280.58 g/mol. Its IUPAC name is 3-propyl-2-(trichloromethyl)-2H-1,3-benzoxazole.
| Compound Name | 3-propyl-2-(trichloromethyl)-2H-1,3-benzoxazole |
|---|---|
| PubChem CID | 121224214 |
| Molecular Formula | C11H12Cl3NO |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 3-propyl-2-(trichloromethyl)-2H-1,3-benzoxazole |
| SMILES | CCCN1c2ccccc2OC1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl3NO/c1-2-7-15-8-5-3-4-6-9(8)16-10(15)11(12,13)14/h3-6,10H,2,7H2,1H3 |
| InChIKey | HFXHHDIYRKPZGP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|