C12H14ClNO2 — CID 174473058
3-(4-chlorobutyl)-2H-1,3-benzoxazole-2-carbaldehyde (PubChem CID 174473058) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 3-(4-chlorobutyl)-2H-1,3-benzoxazole-2-carbaldehyde.
| Compound Name | 3-(4-chlorobutyl)-2H-1,3-benzoxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174473058 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(4-chlorobutyl)-2H-1,3-benzoxazole-2-carbaldehyde |
| SMILES | O=CC1Oc2ccccc2N1CCCCCl |
| InChI | InChI=1S/C12H14ClNO2/c13-7-3-4-8-14-10-5-1-2-6-11(10)16-12(14)9-15/h1-2,5-6,9,12H,3-4,7-8H2 |
| InChIKey | UVMJISSKXVHDPI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|