C15H13NO3 — CID 174921328
3-benzyl-5-hydroxy-2H-1,3-benzoxazole-2-carbaldehyde (PubChem CID 174921328) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-benzyl-5-hydroxy-2H-1,3-benzoxazole-2-carbaldehyde.
| Compound Name | 3-benzyl-5-hydroxy-2H-1,3-benzoxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174921328 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-benzyl-5-hydroxy-2H-1,3-benzoxazole-2-carbaldehyde |
| SMILES | O=CC1Oc2ccc(O)cc2N1Cc1ccccc1 |
| InChI | InChI=1S/C15H13NO3/c17-10-15-16(9-11-4-2-1-3-5-11)13-8-12(18)6-7-14(13)19-15/h1-8,10,15,18H,9H2 |
| InChIKey | JJNDTOCIBCZZLG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|