C16H16N2O2 — CID 174562402
7-amino-4-benzyl-2,3-dihydro-1,4-benzoxazine-3-carbaldehyde (PubChem CID 174562402) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 7-amino-4-benzyl-2,3-dihydro-1,4-benzoxazine-3-carbaldehyde.
| Compound Name | 7-amino-4-benzyl-2,3-dihydro-1,4-benzoxazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174562402 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 7-amino-4-benzyl-2,3-dihydro-1,4-benzoxazine-3-carbaldehyde |
| SMILES | Nc1ccc2c(c1)OCC(C=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c17-13-6-7-15-16(8-13)20-11-14(10-19)18(15)9-12-4-2-1-3-5-12/h1-8,10,14H,9,11,17H2 |
| InChIKey | JIERFMLURTVSAY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|