C15H17NO2 — CID 10514378
(4R)-3-benzyl-4-[(1Z,3E)-penta-1,3-dienyl]-1,3-oxazolidin-2-one (PubChem CID 10514378) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (4R)-3-benzyl-4-[(1Z,3E)-penta-1,3-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-benzyl-4-[(1Z,3E)-penta-1,3-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10514378 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (4R)-3-benzyl-4-[(1Z,3E)-penta-1,3-dienyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/C=C\[C@@H]1COC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H17NO2/c1-2-3-5-10-14-12-18-15(17)16(14)11-13-8-6-4-7-9-13/h2-10,14H,11-12H2,1H3/b3-2+,10-5-/t14-/m1/s1 |
| InChIKey | WIKCDDAVUGSCQQ-ZXMVQZGASA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|