C12H15ClO — CID 66363280
2-(4-chlorobutyl)-2,3-dihydro-1-benzofuran (PubChem CID 66363280) has the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. Its IUPAC name is 2-(4-chlorobutyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 2-(4-chlorobutyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 66363280 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-(4-chlorobutyl)-2,3-dihydro-1-benzofuran |
| SMILES | ClCCCCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H15ClO/c13-8-4-3-6-11-9-10-5-1-2-7-12(10)14-11/h1-2,5,7,11H,3-4,6,8-9H2 |
| InChIKey | NEEDJNUOQMRVSF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|