C10H11ClO — CID 141218488
2-(2-chloroethyl)-2,3-dihydro-1-benzofuran (PubChem CID 141218488) has the molecular formula C10H11ClO and a molecular weight of 182.65 g/mol. Its IUPAC name is 2-(2-chloroethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 2-(2-chloroethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 141218488 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2-(2-chloroethyl)-2,3-dihydro-1-benzofuran |
| SMILES | ClCCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C10H11ClO/c11-6-5-9-7-8-3-1-2-4-10(8)12-9/h1-4,9H,5-7H2 |
| InChIKey | FFHNAEVXPOAPGW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|