C15H21ClO — CID 66363473
2-(4-chloroheptyl)-2,3-dihydro-1-benzofuran (PubChem CID 66363473) has the molecular formula C15H21ClO and a molecular weight of 252.78 g/mol. Its IUPAC name is 2-(4-chloroheptyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 2-(4-chloroheptyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 66363473 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(4-chloroheptyl)-2,3-dihydro-1-benzofuran |
| SMILES | CCCC(Cl)CCCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H21ClO/c1-2-6-13(16)8-5-9-14-11-12-7-3-4-10-15(12)17-14/h3-4,7,10,13-14H,2,5-6,8-9,11H2,1H3 |
| InChIKey | DESPEUBUERQTQD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|