C11H16NO+ — CID 7071467
[(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl-ethylazanium (PubChem CID 7071467) has the molecular formula C11H16NO+ and a molecular weight of 178.26 g/mol. Its IUPAC name is [(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl-ethylazanium.
| Compound Name | [(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl-ethylazanium |
|---|---|
| PubChem CID | 7071467 |
| Molecular Formula | C11H16NO+ |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | [(2R)-2,3-dihydro-1-benzofuran-2-yl]methyl-ethylazanium |
| SMILES | CC[NH2+]C[C@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C11H15NO/c1-2-12-8-10-7-9-5-3-4-6-11(9)13-10/h3-6,10,12H,2,7-8H2,1H3/p+1/t10-/m1/s1 |
| InChIKey | ARWUGHLZFYRZDM-SNVBAGLBSA-O |
| XLogP | 0.57 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |