C10H13NS2 — CID 152670089
3-propyl-2H-1,3-benzothiazole-2-thiol (PubChem CID 152670089) has the molecular formula C10H13NS2 and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-propyl-2H-1,3-benzothiazole-2-thiol.
| Compound Name | 3-propyl-2H-1,3-benzothiazole-2-thiol |
|---|---|
| PubChem CID | 152670089 |
| Molecular Formula | C10H13NS2 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 3-propyl-2H-1,3-benzothiazole-2-thiol |
| SMILES | CCCN1c2ccccc2SC1S |
| InChI | InChI=1S/C10H13NS2/c1-2-7-11-8-5-3-4-6-9(8)13-10(11)12/h3-6,10,12H,2,7H2,1H3 |
| InChIKey | ZLIQMEFZDGCBIV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|