C13H17NO2S — CID 174552873
5-(2-methyl-2H-1,3-benzothiazol-3-yl)pentanoic acid (PubChem CID 174552873) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-(2-methyl-2H-1,3-benzothiazol-3-yl)pentanoic acid.
| Compound Name | 5-(2-methyl-2H-1,3-benzothiazol-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 174552873 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 5-(2-methyl-2H-1,3-benzothiazol-3-yl)pentanoic acid |
| SMILES | CC1Sc2ccccc2N1CCCCC(=O)O |
| InChI | InChI=1S/C13H17NO2S/c1-10-14(9-5-4-8-13(15)16)11-6-2-3-7-12(11)17-10/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,15,16) |
| InChIKey | PEJFVZRAWKWAJA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|