C13H19NS2 — CID 54483251
3-hexyl-2H-1,3-benzothiazole-2-thiol (PubChem CID 54483251) has the molecular formula C13H19NS2 and a molecular weight of 253.44 g/mol. Its IUPAC name is 3-hexyl-2H-1,3-benzothiazole-2-thiol.
| Compound Name | 3-hexyl-2H-1,3-benzothiazole-2-thiol |
|---|---|
| PubChem CID | 54483251 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-hexyl-2H-1,3-benzothiazole-2-thiol |
| SMILES | CCCCCCN1c2ccccc2SC1S |
| InChI | InChI=1S/C13H19NS2/c1-2-3-4-7-10-14-11-8-5-6-9-12(11)16-13(14)15/h5-6,8-9,13,15H,2-4,7,10H2,1H3 |
| InChIKey | XQMSOTZDTOSABH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|