C15H15NO2S — CID 59928109
3-(4a,10a-dihydrophenothiazin-10-yl)propanoic acid (PubChem CID 59928109) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-(4a,10a-dihydrophenothiazin-10-yl)propanoic acid.
| Compound Name | 3-(4a,10a-dihydrophenothiazin-10-yl)propanoic acid |
|---|---|
| PubChem CID | 59928109 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-(4a,10a-dihydrophenothiazin-10-yl)propanoic acid |
| SMILES | O=C(O)CCN1c2ccccc2SC2C=CC=CC21 |
| InChI | InChI=1S/C15H15NO2S/c17-15(18)9-10-16-11-5-1-3-7-13(11)19-14-8-4-2-6-12(14)16/h1-8,11,13H,9-10H2,(H,17,18) |
| InChIKey | OKXQDOQMGSPBHQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |