3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid

C12H11NO3S — CID 22440123

IUPAC3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid
SMILESO=C(O)CCN1C(=O)C=CSc2ccccc21
InChIInChI=1S/C12H11NO3S/c14-11-6-8-17-10-4-2-1-3-9(10)13(11)7-5-12(15)16/h1-4,6,8H,5,7H2,(H,15,16)
InChIKeySIXYXQDJYPAYAF-UHFFFAOYSA-N
MW249.29 g/mol
LogP2.11
Rot. Bonds3

About 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid

3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid (PubChem CID 22440123) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid
PubChem CID22440123
Molecular FormulaC12H11NO3S
Molecular Weight249.29 g/mol
Exact Mass249.05
IUPAC Name3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid
SMILESO=C(O)CCN1C(=O)C=CSc2ccccc21
InChIInChI=1S/C12H11NO3S/c14-11-6-8-17-10-4-2-1-3-9(10)13(11)7-5-12(15)16/h1-4,6,8H,5,7H2,(H,15,16)
InChIKeySIXYXQDJYPAYAF-UHFFFAOYSA-N
XLogP2.11
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.29
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid?
The IUPAC name of 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid (CID 22440123) is 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid.
What is the SMILES notation for 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid?
The canonical SMILES for 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid is O=C(O)CCN1C(=O)C=CSc2ccccc21.
What is the InChIKey of 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid?
The InChIKey is SIXYXQDJYPAYAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3S/c14-11-6-8-17-10-4-2-1-3-9(10)13(11)7-5-12(15)16/h1-4,6,8H,5,7H2,(H,15,16).
What are the key properties of 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid?
3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid has a molecular weight of 249.29 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-oxo-1,5-benzothiazepin-5-yl)propanoic acid is sourced from PubChem (CID 22440123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).