C22H19N5O3S — CID 134821519
10-[[1-(2-methoxy-4-nitrophenyl)triazol-4-yl]methyl]-4a,10a-dihydrophenothiazine (PubChem CID 134821519) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is 10-[[1-(2-methoxy-4-nitrophenyl)triazol-4-yl]methyl]-4a,10a-dihydrophenothiazine.
| Compound Name | 10-[[1-(2-methoxy-4-nitrophenyl)triazol-4-yl]methyl]-4a,10a-dihydrophenothiazine |
|---|---|
| PubChem CID | 134821519 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 10-[[1-(2-methoxy-4-nitrophenyl)triazol-4-yl]methyl]-4a,10a-dihydrophenothiazine |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1cc(CN2c3ccccc3SC3C=CC=CC32)nn1 |
| InChI | InChI=1S/C22H19N5O3S/c1-30-20-12-16(27(28)29)10-11-17(20)26-14-15(23-24-26)13-25-18-6-2-4-8-21(18)31-22-9-5-3-7-19(22)25/h2-12,14,18,21H,13H2,1H3 |
| InChIKey | YPSFGNVEOVPXLM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|