C29H34F3N3O8S — CID 134688224
bis(but-2-enedioic acid);10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-4a,10a-dihydrophenothiazine (PubChem CID 134688224) has the molecular formula C29H34F3N3O8S and a molecular weight of 641.67 g/mol. Its IUPAC name is bis(but-2-enedioic acid);10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-4a,10a-dihydrophenothiazine.
| Compound Name | bis(but-2-enedioic acid);10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-4a,10a-dihydrophenothiazine |
|---|---|
| PubChem CID | 134688224 |
| Molecular Formula | C29H34F3N3O8S |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | bis(but-2-enedioic acid);10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-4a,10a-dihydrophenothiazine |
| SMILES | CN1CCN(CCCN2c3ccccc3SC3C=CC(C(F)(F)F)=CC32)CC1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C21H26F3N3S.2C4H4O4/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)28-20-8-7-16(15-18(20)27)21(22,23)24;2*5-3(6)1-2-4(7)8/h2-3,5-8,15,18,20H,4,9-14H2,1H3;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | PTUDKEZAGXSBFX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|