C33H43N3O9S — CID 25111329
bis((Z)-but-2-enedioic acid);3-butoxy-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine (PubChem CID 25111329) has the molecular formula C33H43N3O9S and a molecular weight of 657.79 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);3-butoxy-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine.
| Compound Name | bis((Z)-but-2-enedioic acid);3-butoxy-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine |
|---|---|
| PubChem CID | 25111329 |
| Molecular Formula | C33H43N3O9S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);3-butoxy-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine |
| SMILES | CCCCOc1ccc2c(c1)Sc1ccccc1N2CCCCN1CCN(C)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H35N3OS.2C4H4O4/c1-3-4-19-29-21-11-12-23-25(20-21)30-24-10-6-5-9-22(24)28(23)14-8-7-13-27-17-15-26(2)16-18-27;2*5-3(6)1-2-4(7)8/h5-6,9-12,20H,3-4,7-8,13-19H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | WCIYQPZSLNAGPB-SPIKMXEPSA-N |
| XLogP | 4.92 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|