C25H30N6O4S — CID 6477889
3-azido-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine;(E)-but-2-enedioic acid (PubChem CID 6477889) has the molecular formula C25H30N6O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is 3-azido-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine;(E)-but-2-enedioic acid.
| Compound Name | 3-azido-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 6477889 |
| Molecular Formula | C25H30N6O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 3-azido-10-[4-(4-methylpiperazin-1-yl)butyl]phenothiazine;(E)-but-2-enedioic acid |
| SMILES | CN1CCN(CCCCN2c3ccccc3Sc3cc(N=[N+]=[N-])ccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H26N6S.C4H4O4/c1-25-12-14-26(15-13-25)10-4-5-11-27-18-6-2-3-7-20(18)28-21-16-17(23-24-22)8-9-19(21)27;5-3(6)1-2-4(7)8/h2-3,6-9,16H,4-5,10-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QQKXCNKYYAANAL-WLHGVMLRSA-N |
| XLogP | 4.97 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|