C22H26N2O2S — CID 50852383
1-(4-phenothiazin-10-ylbutyl)piperidine-4-carboxylic acid (PubChem CID 50852383) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(4-phenothiazin-10-ylbutyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(4-phenothiazin-10-ylbutyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 50852383 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-(4-phenothiazin-10-ylbutyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(CCCCN2c3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C22H26N2O2S/c25-22(26)17-11-15-23(16-12-17)13-5-6-14-24-18-7-1-3-9-20(18)27-21-10-4-2-8-19(21)24/h1-4,7-10,17H,5-6,11-16H2,(H,25,26) |
| InChIKey | OTAKXWAPGOMOFB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|