C20H20N2O3S — CID 119371996
(2R)-1-(3-phenothiazin-10-ylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 119371996) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is (2R)-1-(3-phenothiazin-10-ylpropanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(3-phenothiazin-10-ylpropanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119371996 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2R)-1-(3-phenothiazin-10-ylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C20H20N2O3S/c23-19(22-12-5-8-16(22)20(24)25)11-13-21-14-6-1-3-9-17(14)26-18-10-4-2-7-15(18)21/h1-4,6-7,9-10,16H,5,8,11-13H2,(H,24,25)/t16-/m1/s1 |
| InChIKey | GOFCRKHGNMDOGZ-MRXNPFEDSA-N |
| XLogP | 3.76 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|