C14H12ClNOS — CID 736382
1-[(4aS,10aS)-4a,10a-dihydrophenothiazin-10-yl]-2-chloroethanone (PubChem CID 736382) has the molecular formula C14H12ClNOS and a molecular weight of 277.78 g/mol. Its IUPAC name is 1-[(4aS,10aS)-4a,10a-dihydrophenothiazin-10-yl]-2-chloroethanone.
| Compound Name | 1-[(4aS,10aS)-4a,10a-dihydrophenothiazin-10-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 736382 |
| Molecular Formula | C14H12ClNOS |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 1-[(4aS,10aS)-4a,10a-dihydrophenothiazin-10-yl]-2-chloroethanone |
| SMILES | O=C(CCl)N1c2ccccc2S[C@H]2C=CC=C[C@@H]21 |
| InChI | InChI=1S/C14H12ClNOS/c15-9-14(17)16-10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)16/h1-8,10,12H,9H2/t10-,12-/m0/s1 |
| InChIKey | MJWFQSVXOXKRRF-JQWIXIFHSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|