C14H22N2S2 — CID 155319447
S-(3-heptyl-2H-1,3-benzothiazol-2-yl)thiohydroxylamine (PubChem CID 155319447) has the molecular formula C14H22N2S2 and a molecular weight of 282.48 g/mol. Its IUPAC name is S-(3-heptyl-2H-1,3-benzothiazol-2-yl)thiohydroxylamine.
| Compound Name | S-(3-heptyl-2H-1,3-benzothiazol-2-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 155319447 |
| Molecular Formula | C14H22N2S2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | S-(3-heptyl-2H-1,3-benzothiazol-2-yl)thiohydroxylamine |
| SMILES | CCCCCCCN1c2ccccc2SC1SN |
| InChI | InChI=1S/C14H22N2S2/c1-2-3-4-5-8-11-16-12-9-6-7-10-13(12)17-14(16)18-15/h6-7,9-10,14H,2-5,8,11,15H2,1H3 |
| InChIKey | QUUJCOXAQGODFC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|