C15H23NS2 — CID 10379010
2-nonyl-1,3,2-benzodithiazole (PubChem CID 10379010) has the molecular formula C15H23NS2 and a molecular weight of 281.49 g/mol. Its IUPAC name is 2-nonyl-1,3,2-benzodithiazole.
| Compound Name | 2-nonyl-1,3,2-benzodithiazole |
|---|---|
| PubChem CID | 10379010 |
| Molecular Formula | C15H23NS2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-nonyl-1,3,2-benzodithiazole |
| SMILES | CCCCCCCCCN1Sc2ccccc2S1 |
| InChI | InChI=1S/C15H23NS2/c1-2-3-4-5-6-7-10-13-16-17-14-11-8-9-12-15(14)18-16/h8-9,11-12H,2-7,10,13H2,1H3 |
| InChIKey | FRVCFUSYYNURLY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|