C18H29NS2 — CID 57005164
3-dodecyl-1,2,3-benzodithiazole (PubChem CID 57005164) has the molecular formula C18H29NS2 and a molecular weight of 323.57 g/mol. Its IUPAC name is 3-dodecyl-1,2,3-benzodithiazole.
| Compound Name | 3-dodecyl-1,2,3-benzodithiazole |
|---|---|
| PubChem CID | 57005164 |
| Molecular Formula | C18H29NS2 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-dodecyl-1,2,3-benzodithiazole |
| SMILES | CCCCCCCCCCCCN1SSc2ccccc21 |
| InChI | InChI=1S/C18H29NS2/c1-2-3-4-5-6-7-8-9-10-13-16-19-17-14-11-12-15-18(17)20-21-19/h11-12,14-15H,2-10,13,16H2,1H3 |
| InChIKey | NAVFOZPGKAHDCM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|