C18H30N2 — CID 63527317
(1-octyl-3,4-dihydro-2H-quinolin-2-yl)methanamine (PubChem CID 63527317) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is (1-octyl-3,4-dihydro-2H-quinolin-2-yl)methanamine.
| Compound Name | (1-octyl-3,4-dihydro-2H-quinolin-2-yl)methanamine |
|---|---|
| PubChem CID | 63527317 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | (1-octyl-3,4-dihydro-2H-quinolin-2-yl)methanamine |
| SMILES | CCCCCCCCN1c2ccccc2CCC1CN |
| InChI | InChI=1S/C18H30N2/c1-2-3-4-5-6-9-14-20-17(15-19)13-12-16-10-7-8-11-18(16)20/h7-8,10-11,17H,2-6,9,12-15,19H2,1H3 |
| InChIKey | CUZMQXOQBGUTDE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|