C17H25N — CID 11096828
2-cyclopropyl-1-hexyl-2,3-dihydroindole (PubChem CID 11096828) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-cyclopropyl-1-hexyl-2,3-dihydroindole.
| Compound Name | 2-cyclopropyl-1-hexyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 11096828 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2-cyclopropyl-1-hexyl-2,3-dihydroindole |
| SMILES | CCCCCCN1c2ccccc2CC1C1CC1 |
| InChI | InChI=1S/C17H25N/c1-2-3-4-7-12-18-16-9-6-5-8-15(16)13-17(18)14-10-11-14/h5-6,8-9,14,17H,2-4,7,10-13H2,1H3 |
| InChIKey | RNTPQSWPBURCIK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|