1-propyl-2,3-dihydroindole-2-carboxylic acid

C12H15NO2 — CID 80566723

IUPAC1-propyl-2,3-dihydroindole-2-carboxylic acid
SMILESCCCN1c2ccccc2CC1C(=O)O
InChIInChI=1S/C12H15NO2/c1-2-7-13-10-6-4-3-5-9(10)8-11(13)12(14)15/h3-6,11H,2,7-8H2,1H3,(H,14,15)
InChIKeyWISSKBRDPZEYOD-UHFFFAOYSA-N
MW205.26 g/mol
LogP1.91
Rot. Bonds3

About 1-propyl-2,3-dihydroindole-2-carboxylic acid

1-propyl-2,3-dihydroindole-2-carboxylic acid (PubChem CID 80566723) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-propyl-2,3-dihydroindole-2-carboxylic acid.

Molecular Properties

Compound Name1-propyl-2,3-dihydroindole-2-carboxylic acid
PubChem CID80566723
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Name1-propyl-2,3-dihydroindole-2-carboxylic acid
SMILESCCCN1c2ccccc2CC1C(=O)O
InChIInChI=1S/C12H15NO2/c1-2-7-13-10-6-4-3-5-9(10)8-11(13)12(14)15/h3-6,11H,2,7-8H2,1H3,(H,14,15)
InChIKeyWISSKBRDPZEYOD-UHFFFAOYSA-N
XLogP1.91
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-propyl-2,3-dihydroindole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-propyl-2,3-dihydroindole-2-carboxylic acid?
The IUPAC name of 1-propyl-2,3-dihydroindole-2-carboxylic acid (CID 80566723) is 1-propyl-2,3-dihydroindole-2-carboxylic acid.
What is the SMILES notation for 1-propyl-2,3-dihydroindole-2-carboxylic acid?
The canonical SMILES for 1-propyl-2,3-dihydroindole-2-carboxylic acid is CCCN1c2ccccc2CC1C(=O)O.
What is the InChIKey of 1-propyl-2,3-dihydroindole-2-carboxylic acid?
The InChIKey is WISSKBRDPZEYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-7-13-10-6-4-3-5-9(10)8-11(13)12(14)15/h3-6,11H,2,7-8H2,1H3,(H,14,15).
What are the key properties of 1-propyl-2,3-dihydroindole-2-carboxylic acid?
1-propyl-2,3-dihydroindole-2-carboxylic acid has a molecular weight of 205.26 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-2,3-dihydroindole-2-carboxylic acid is sourced from PubChem (CID 80566723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).