C13H17NO — CID 115106307
1-(1-propyl-2,3-dihydroindol-2-yl)ethanone (PubChem CID 115106307) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-(1-propyl-2,3-dihydroindol-2-yl)ethanone.
| Compound Name | 1-(1-propyl-2,3-dihydroindol-2-yl)ethanone |
|---|---|
| PubChem CID | 115106307 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(1-propyl-2,3-dihydroindol-2-yl)ethanone |
| SMILES | CCCN1c2ccccc2CC1C(C)=O |
| InChI | InChI=1S/C13H17NO/c1-3-8-14-12-7-5-4-6-11(12)9-13(14)10(2)15/h4-7,13H,3,8-9H2,1-2H3 |
| InChIKey | GJMYWIXMKFFWEZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |