C15H23N — CID 176730393
1-methyl-3-pentyl-3,4-dihydro-2H-quinoline (PubChem CID 176730393) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-methyl-3-pentyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-methyl-3-pentyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 176730393 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-methyl-3-pentyl-3,4-dihydro-2H-quinoline |
| SMILES | CCCCCC1Cc2ccccc2N(C)C1 |
| InChI | InChI=1S/C15H23N/c1-3-4-5-8-13-11-14-9-6-7-10-15(14)16(2)12-13/h6-7,9-10,13H,3-5,8,11-12H2,1-2H3 |
| InChIKey | WHSLTDPVAFVTKM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|