About ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline
ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 142002286) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 142002286 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC.CN1CC(Cn2ccnc2)Cc2ccccc21 |
| InChI | InChI=1S/C14H17N3.C2H6/c1-16-9-12(10-17-7-6-15-11-17)8-13-4-2-3-5-14(13)16;1-2/h2-7,11-12H,8-10H2,1H3;1-2H3 |
| InChIKey | NETXVRWOPVLYOB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline (CID 142002286) is ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline is CC.CN1CC(Cn2ccnc2)Cc2ccccc21.
What is the InChIKey of ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is NETXVRWOPVLYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3.C2H6/c1-16-9-12(10-17-7-6-15-11-17)8-13-4-2-3-5-14(13)16;1-2/h2-7,11-12H,8-10H2,1H3;1-2H3.
What are the key properties of ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline?
ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 257.38 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(imidazol-1-ylmethyl)-1-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 142002286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).