C13H19NO — CID 3590448
3-(1-methyl-3,4-dihydro-2H-quinolin-3-yl)propan-1-ol (PubChem CID 3590448) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-(1-methyl-3,4-dihydro-2H-quinolin-3-yl)propan-1-ol.
| Compound Name | 3-(1-methyl-3,4-dihydro-2H-quinolin-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 3590448 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-(1-methyl-3,4-dihydro-2H-quinolin-3-yl)propan-1-ol |
| SMILES | CN1CC(CCCO)Cc2ccccc21 |
| InChI | InChI=1S/C13H19NO/c1-14-10-11(5-4-8-15)9-12-6-2-3-7-13(12)14/h2-3,6-7,11,15H,4-5,8-10H2,1H3 |
| InChIKey | OKHXDJSBAUNQHV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |