C13H20N2 — CID 146573468
1-butyl-3,4-dihydro-2H-quinolin-2-amine (PubChem CID 146573468) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-butyl-3,4-dihydro-2H-quinolin-2-amine.
| Compound Name | 1-butyl-3,4-dihydro-2H-quinolin-2-amine |
|---|---|
| PubChem CID | 146573468 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-butyl-3,4-dihydro-2H-quinolin-2-amine |
| SMILES | CCCCN1c2ccccc2CCC1N |
| InChI | InChI=1S/C13H20N2/c1-2-3-10-15-12-7-5-4-6-11(12)8-9-13(15)14/h4-7,13H,2-3,8-10,14H2,1H3 |
| InChIKey | XIONMALYNQGVOY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |