C13H18N4 — CID 61396775
1-(3-azidopropyl)-2-methyl-3,4-dihydro-2H-quinoline (PubChem CID 61396775) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(3-azidopropyl)-2-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(3-azidopropyl)-2-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 61396775 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-(3-azidopropyl)-2-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1CCc2ccccc2N1CCCN=[N+]=[N-] |
| InChI | InChI=1S/C13H18N4/c1-11-7-8-12-5-2-3-6-13(12)17(11)10-4-9-15-16-14/h2-3,5-6,11H,4,7-10H2,1H3 |
| InChIKey | QFJMCTOSODEUHF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|