C9H9NO2S2 — CID 139620868
methyl 2-sulfanyl-2H-1,3-benzothiazole-3-carboxylate (PubChem CID 139620868) has the molecular formula C9H9NO2S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is methyl 2-sulfanyl-2H-1,3-benzothiazole-3-carboxylate.
| Compound Name | methyl 2-sulfanyl-2H-1,3-benzothiazole-3-carboxylate |
|---|---|
| PubChem CID | 139620868 |
| Molecular Formula | C9H9NO2S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | methyl 2-sulfanyl-2H-1,3-benzothiazole-3-carboxylate |
| SMILES | COC(=O)N1c2ccccc2SC1S |
| InChI | InChI=1S/C9H9NO2S2/c1-12-8(11)10-6-4-2-3-5-7(6)14-9(10)13/h2-5,9,13H,1H3 |
| InChIKey | REWYPSQTQNIICL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|