C13H17NS — CID 173287101
3-prop-2-enyl-2-propyl-2H-1,3-benzothiazole (PubChem CID 173287101) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 3-prop-2-enyl-2-propyl-2H-1,3-benzothiazole.
| Compound Name | 3-prop-2-enyl-2-propyl-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 173287101 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-prop-2-enyl-2-propyl-2H-1,3-benzothiazole |
| SMILES | C=CCN1c2ccccc2SC1CCC |
| InChI | InChI=1S/C13H17NS/c1-3-7-13-14(10-4-2)11-8-5-6-9-12(11)15-13/h4-6,8-9,13H,2-3,7,10H2,1H3 |
| InChIKey | OSEQIFHJXVDHQW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|