C12H15NOS — CID 14360336
4-(3-methyl-2H-1,3-benzothiazol-2-yl)butan-2-one (PubChem CID 14360336) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-(3-methyl-2H-1,3-benzothiazol-2-yl)butan-2-one.
| Compound Name | 4-(3-methyl-2H-1,3-benzothiazol-2-yl)butan-2-one |
|---|---|
| PubChem CID | 14360336 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-(3-methyl-2H-1,3-benzothiazol-2-yl)butan-2-one |
| SMILES | CC(=O)CCC1Sc2ccccc2N1C |
| InChI | InChI=1S/C12H15NOS/c1-9(14)7-8-12-13(2)10-5-3-4-6-11(10)15-12/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | FILHMWACGQXXPN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |