C9H11ClN2OS — CID 175255836
3-methyl-2H-1,3-benzothiazole-2-carboxamide;hydrochloride (PubChem CID 175255836) has the molecular formula C9H11ClN2OS and a molecular weight of 230.72 g/mol. Its IUPAC name is 3-methyl-2H-1,3-benzothiazole-2-carboxamide;hydrochloride.
| Compound Name | 3-methyl-2H-1,3-benzothiazole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 175255836 |
| Molecular Formula | C9H11ClN2OS |
| Molecular Weight | 230.72 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-methyl-2H-1,3-benzothiazole-2-carboxamide;hydrochloride |
| SMILES | CN1c2ccccc2SC1C(N)=O.Cl |
| InChI | InChI=1S/C9H10N2OS.ClH/c1-11-6-4-2-3-5-7(6)13-9(11)8(10)12;/h2-5,9H,1H3,(H2,10,12);1H |
| InChIKey | IDJVXVLWFZFMDF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.72 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |