C9H11NO2S2 — CID 174635092
(3-methyl-2H-1,3-benzothiazol-2-yl)methanesulfinic acid (PubChem CID 174635092) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is (3-methyl-2H-1,3-benzothiazol-2-yl)methanesulfinic acid.
| Compound Name | (3-methyl-2H-1,3-benzothiazol-2-yl)methanesulfinic acid |
|---|---|
| PubChem CID | 174635092 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | (3-methyl-2H-1,3-benzothiazol-2-yl)methanesulfinic acid |
| SMILES | CN1c2ccccc2SC1CS(=O)O |
| InChI | InChI=1S/C9H11NO2S2/c1-10-7-4-2-3-5-8(7)13-9(10)6-14(11)12/h2-5,9H,6H2,1H3,(H,11,12) |
| InChIKey | WRTGDBDFWGQPRG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|