C12H19NOSSi — CID 150195289
3-(3-hydroxy-2H-1,3-benzothiazol-2-yl)propyl-dimethylsilane (PubChem CID 150195289) has the molecular formula C12H19NOSSi and a molecular weight of 253.44 g/mol. Its IUPAC name is 3-(3-hydroxy-2H-1,3-benzothiazol-2-yl)propyl-dimethylsilane.
| Compound Name | 3-(3-hydroxy-2H-1,3-benzothiazol-2-yl)propyl-dimethylsilane |
|---|---|
| PubChem CID | 150195289 |
| Molecular Formula | C12H19NOSSi |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-(3-hydroxy-2H-1,3-benzothiazol-2-yl)propyl-dimethylsilane |
| SMILES | C[SiH](C)CCCC1Sc2ccccc2N1O |
| InChI | InChI=1S/C12H19NOSSi/c1-16(2)9-5-8-12-13(14)10-6-3-4-7-11(10)15-12/h3-4,6-7,12,14,16H,5,8-9H2,1-2H3 |
| InChIKey | FOHYXIQWXRQOES-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|