C12H15NOS — CID 126516811
4-(3-methyl-2H-1,3-benzothiazol-2-yl)but-2-en-2-ol (PubChem CID 126516811) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-(3-methyl-2H-1,3-benzothiazol-2-yl)but-2-en-2-ol.
| Compound Name | 4-(3-methyl-2H-1,3-benzothiazol-2-yl)but-2-en-2-ol |
|---|---|
| PubChem CID | 126516811 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-(3-methyl-2H-1,3-benzothiazol-2-yl)but-2-en-2-ol |
| SMILES | CC(O)=CCC1Sc2ccccc2N1C |
| InChI | InChI=1S/C12H15NOS/c1-9(14)7-8-12-13(2)10-5-3-4-6-11(10)15-12/h3-7,12,14H,8H2,1-2H3 |
| InChIKey | OPOZERKPSJIROF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|